C9H17F3N2O3S — CID 106543952
[2-(2,2,2-trifluoroethylsulfamoylamino)cyclohexyl]methanol (PubChem CID 106543952) has the molecular formula C9H17F3N2O3S and a molecular weight of 290.31 g/mol. Its IUPAC name is [2-(2,2,2-trifluoroethylsulfamoylamino)cyclohexyl]methanol.
| Compound Name | [2-(2,2,2-trifluoroethylsulfamoylamino)cyclohexyl]methanol |
|---|---|
| PubChem CID | 106543952 |
| Molecular Formula | C9H17F3N2O3S |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | [2-(2,2,2-trifluoroethylsulfamoylamino)cyclohexyl]methanol |
| SMILES | O=S(=O)(NCC(F)(F)F)NC1CCCCC1CO |
| InChI | InChI=1S/C9H17F3N2O3S/c10-9(11,12)6-13-18(16,17)14-8-4-2-1-3-7(8)5-15/h7-8,13-15H,1-6H2 |
| InChIKey | ZDOFNGQXPAJGHG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |