C9H19NO3S — CID 86708972
N-[(1S,2S)-2-(hydroxymethyl)cyclohexyl]ethanesulfonamide (PubChem CID 86708972) has the molecular formula C9H19NO3S and a molecular weight of 221.32 g/mol. Its IUPAC name is N-[(1S,2S)-2-(hydroxymethyl)cyclohexyl]ethanesulfonamide.
| Compound Name | N-[(1S,2S)-2-(hydroxymethyl)cyclohexyl]ethanesulfonamide |
|---|---|
| PubChem CID | 86708972 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | N-[(1S,2S)-2-(hydroxymethyl)cyclohexyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)N[C@H]1CCCC[C@@H]1CO |
| InChI | InChI=1S/C9H19NO3S/c1-2-14(12,13)10-9-6-4-3-5-8(9)7-11/h8-11H,2-7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | GXQSOHGEMOLRES-BDAKNGLRSA-N |
| XLogP | 0.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |