C9H15F3N2O — CID 93451955
N-[(1R,2R)-2-aminocyclohexyl]-3,3,3-trifluoropropanamide (PubChem CID 93451955) has the molecular formula C9H15F3N2O and a molecular weight of 224.23 g/mol. Its IUPAC name is N-[(1R,2R)-2-aminocyclohexyl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[(1R,2R)-2-aminocyclohexyl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 93451955 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | N-[(1R,2R)-2-aminocyclohexyl]-3,3,3-trifluoropropanamide |
| SMILES | N[C@@H]1CCCC[C@H]1NC(=O)CC(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O/c10-9(11,12)5-8(15)14-7-4-2-1-3-6(7)13/h6-7H,1-5,13H2,(H,14,15)/t6-,7-/m1/s1 |
| InChIKey | JAHBZBQROKIQJT-RNFRBKRXSA-N |
| XLogP | 1.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |