C14H26N2O3 — CID 61403433
4-[(2-aminocyclohexyl)amino]-2,2-diethyl-4-oxobutanoic acid (PubChem CID 61403433) has the molecular formula C14H26N2O3 and a molecular weight of 270.37 g/mol. Its IUPAC name is 4-[(2-aminocyclohexyl)amino]-2,2-diethyl-4-oxobutanoic acid.
| Compound Name | 4-[(2-aminocyclohexyl)amino]-2,2-diethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 61403433 |
| Molecular Formula | C14H26N2O3 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 4-[(2-aminocyclohexyl)amino]-2,2-diethyl-4-oxobutanoic acid |
| SMILES | CCC(CC)(CC(=O)NC1CCCCC1N)C(=O)O |
| InChI | InChI=1S/C14H26N2O3/c1-3-14(4-2,13(18)19)9-12(17)16-11-8-6-5-7-10(11)15/h10-11H,3-9,15H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | MHLLQDWOHLIBOP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |