C13H20ClN3O3 — CID 106362266
4-chloro-2-(2-hydroxyethyl)-5-[[2-(hydroxymethyl)cyclohexyl]amino]pyridazin-3-one (PubChem CID 106362266) has the molecular formula C13H20ClN3O3 and a molecular weight of 301.77 g/mol. Its IUPAC name is 4-chloro-2-(2-hydroxyethyl)-5-[[2-(hydroxymethyl)cyclohexyl]amino]pyridazin-3-one.
| Compound Name | 4-chloro-2-(2-hydroxyethyl)-5-[[2-(hydroxymethyl)cyclohexyl]amino]pyridazin-3-one |
|---|---|
| PubChem CID | 106362266 |
| Molecular Formula | C13H20ClN3O3 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 4-chloro-2-(2-hydroxyethyl)-5-[[2-(hydroxymethyl)cyclohexyl]amino]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NC2CCCCC2CO)cnn1CCO |
| InChI | InChI=1S/C13H20ClN3O3/c14-12-11(7-15-17(5-6-18)13(12)20)16-10-4-2-1-3-9(10)8-19/h7,9-10,16,18-19H,1-6,8H2 |
| InChIKey | CKAWCNBNWYOKCM-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |