C10H14ClN3O3 — CID 114439735
4-chloro-5-[(3-hydroxycyclobutyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one (PubChem CID 114439735) has the molecular formula C10H14ClN3O3 and a molecular weight of 259.69 g/mol. Its IUPAC name is 4-chloro-5-[(3-hydroxycyclobutyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one.
| Compound Name | 4-chloro-5-[(3-hydroxycyclobutyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 114439735 |
| Molecular Formula | C10H14ClN3O3 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 4-chloro-5-[(3-hydroxycyclobutyl)amino]-2-(2-hydroxyethyl)pyridazin-3-one |
| SMILES | O=c1c(Cl)c(NC2CC(O)C2)cnn1CCO |
| InChI | InChI=1S/C10H14ClN3O3/c11-9-8(13-6-3-7(16)4-6)5-12-14(1-2-15)10(9)17/h5-7,13,15-16H,1-4H2 |
| InChIKey | XGUMIRLUKPODMS-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |