C16H20N2O2S — CID 106363178
methyl 2-(4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-ylamino)-2-phenylacetate (PubChem CID 106363178) has the molecular formula C16H20N2O2S and a molecular weight of 304.41 g/mol. Its IUPAC name is methyl 2-(4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-ylamino)-2-phenylacetate.
| Compound Name | methyl 2-(4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-ylamino)-2-phenylacetate |
|---|---|
| PubChem CID | 106363178 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | methyl 2-(4,4a,5,6,7,7a-hexahydrocyclopenta[d][1,3]thiazin-2-ylamino)-2-phenylacetate |
| SMILES | COC(=O)C(NC1=NC2CCCC2CS1)c1ccccc1 |
| InChI | InChI=1S/C16H20N2O2S/c1-20-15(19)14(11-6-3-2-4-7-11)18-16-17-13-9-5-8-12(13)10-21-16/h2-4,6-7,12-14H,5,8-10H2,1H3,(H,17,18) |
| InChIKey | RYFJHVOSWCSRPE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |