C14H18ClF2N — CID 106365303
2-(chloromethyl)-N-[(2,4-difluorophenyl)methyl]cyclohexan-1-amine (PubChem CID 106365303) has the molecular formula C14H18ClF2N and a molecular weight of 273.75 g/mol. Its IUPAC name is 2-(chloromethyl)-N-[(2,4-difluorophenyl)methyl]cyclohexan-1-amine.
| Compound Name | 2-(chloromethyl)-N-[(2,4-difluorophenyl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 106365303 |
| Molecular Formula | C14H18ClF2N |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-(chloromethyl)-N-[(2,4-difluorophenyl)methyl]cyclohexan-1-amine |
| SMILES | Fc1ccc(CNC2CCCCC2CCl)c(F)c1 |
| InChI | InChI=1S/C14H18ClF2N/c15-8-10-3-1-2-4-14(10)18-9-11-5-6-12(16)7-13(11)17/h5-7,10,14,18H,1-4,8-9H2 |
| InChIKey | OAMXEAWBTHTWFC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|