C16H23F2N — CID 62197668
2-[(2,4-difluorophenyl)methyl]-N-propylcyclohexan-1-amine (PubChem CID 62197668) has the molecular formula C16H23F2N and a molecular weight of 267.36 g/mol. Its IUPAC name is 2-[(2,4-difluorophenyl)methyl]-N-propylcyclohexan-1-amine.
| Compound Name | 2-[(2,4-difluorophenyl)methyl]-N-propylcyclohexan-1-amine |
|---|---|
| PubChem CID | 62197668 |
| Molecular Formula | C16H23F2N |
| Molecular Weight | 267.36 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 2-[(2,4-difluorophenyl)methyl]-N-propylcyclohexan-1-amine |
| SMILES | CCCNC1CCCCC1Cc1ccc(F)cc1F |
| InChI | InChI=1S/C16H23F2N/c1-2-9-19-16-6-4-3-5-13(16)10-12-7-8-14(17)11-15(12)18/h7-8,11,13,16,19H,2-6,9-10H2,1H3 |
| InChIKey | ZDMRRNHMSISJKW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |