C14H23ClN4 — CID 106365704
N-[2-(chloromethyl)cyclohexyl]-5,6-diethyl-1,2,4-triazin-3-amine (PubChem CID 106365704) has the molecular formula C14H23ClN4 and a molecular weight of 282.82 g/mol. Its IUPAC name is N-[2-(chloromethyl)cyclohexyl]-5,6-diethyl-1,2,4-triazin-3-amine.
| Compound Name | N-[2-(chloromethyl)cyclohexyl]-5,6-diethyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 106365704 |
| Molecular Formula | C14H23ClN4 |
| Molecular Weight | 282.82 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | N-[2-(chloromethyl)cyclohexyl]-5,6-diethyl-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(NC2CCCCC2CCl)nc1CC |
| InChI | InChI=1S/C14H23ClN4/c1-3-11-12(4-2)18-19-14(16-11)17-13-8-6-5-7-10(13)9-15/h10,13H,3-9H2,1-2H3,(H,16,17,19) |
| InChIKey | SCUVROQIRRYQOK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.82 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|