C16H21N5O — CID 167800853
5,6-diethyl-N-[(2R,3S)-2-pyridin-3-yloxolan-3-yl]-1,2,4-triazin-3-amine (PubChem CID 167800853) has the molecular formula C16H21N5O and a molecular weight of 299.38 g/mol. Its IUPAC name is 5,6-diethyl-N-[(2R,3S)-2-pyridin-3-yloxolan-3-yl]-1,2,4-triazin-3-amine.
| Compound Name | 5,6-diethyl-N-[(2R,3S)-2-pyridin-3-yloxolan-3-yl]-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 167800853 |
| Molecular Formula | C16H21N5O |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 5,6-diethyl-N-[(2R,3S)-2-pyridin-3-yloxolan-3-yl]-1,2,4-triazin-3-amine |
| SMILES | CCc1nnc(N[C@H]2CCO[C@@H]2c2cccnc2)nc1CC |
| InChI | InChI=1S/C16H21N5O/c1-3-12-13(4-2)20-21-16(18-12)19-14-7-9-22-15(14)11-6-5-8-17-10-11/h5-6,8,10,14-15H,3-4,7,9H2,1-2H3,(H,18,19,21)/t14-,15+/m0/s1 |
| InChIKey | CCVNAGUBBIRXPX-LSDHHAIUSA-N |
| XLogP | 2.33 |
| TPSA | 72.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |