C20H26N2O3 — CID 120916508
(2R,3S)-N-[[3-(ethoxymethyl)-4-methoxyphenyl]methyl]-2-pyridin-3-yloxolan-3-amine (PubChem CID 120916508) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is (2R,3S)-N-[[3-(ethoxymethyl)-4-methoxyphenyl]methyl]-2-pyridin-3-yloxolan-3-amine.
| Compound Name | (2R,3S)-N-[[3-(ethoxymethyl)-4-methoxyphenyl]methyl]-2-pyridin-3-yloxolan-3-amine |
|---|---|
| PubChem CID | 120916508 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | (2R,3S)-N-[[3-(ethoxymethyl)-4-methoxyphenyl]methyl]-2-pyridin-3-yloxolan-3-amine |
| SMILES | CCOCc1cc(CN[C@H]2CCO[C@@H]2c2cccnc2)ccc1OC |
| InChI | InChI=1S/C20H26N2O3/c1-3-24-14-17-11-15(6-7-19(17)23-2)12-22-18-8-10-25-20(18)16-5-4-9-21-13-16/h4-7,9,11,13,18,20,22H,3,8,10,12,14H2,1-2H3/t18-,20+/m0/s1 |
| InChIKey | HVXMBTFXFMROIL-AZUAARDMSA-N |
| XLogP | 3.25 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|