C22H24N2O2 — CID 126802991
(2R,3S)-N-[[5-(4-ethylphenyl)furan-2-yl]methyl]-2-pyridin-3-yloxolan-3-amine (PubChem CID 126802991) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is (2R,3S)-N-[[5-(4-ethylphenyl)furan-2-yl]methyl]-2-pyridin-3-yloxolan-3-amine.
| Compound Name | (2R,3S)-N-[[5-(4-ethylphenyl)furan-2-yl]methyl]-2-pyridin-3-yloxolan-3-amine |
|---|---|
| PubChem CID | 126802991 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (2R,3S)-N-[[5-(4-ethylphenyl)furan-2-yl]methyl]-2-pyridin-3-yloxolan-3-amine |
| SMILES | CCc1ccc(-c2ccc(CN[C@H]3CCO[C@@H]3c3cccnc3)o2)cc1 |
| InChI | InChI=1S/C22H24N2O2/c1-2-16-5-7-17(8-6-16)21-10-9-19(26-21)15-24-20-11-13-25-22(20)18-4-3-12-23-14-18/h3-10,12,14,20,22,24H,2,11,13,15H2,1H3/t20-,22+/m0/s1 |
| InChIKey | ZGOJYRHIZBHZFW-RBBKRZOGSA-N |
| XLogP | 4.52 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |