C16H17ClFNOS — CID 106366646
N-[2-(chloromethyl)cyclohexyl]-6-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 106366646) has the molecular formula C16H17ClFNOS and a molecular weight of 325.84 g/mol. Its IUPAC name is N-[2-(chloromethyl)cyclohexyl]-6-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | N-[2-(chloromethyl)cyclohexyl]-6-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 106366646 |
| Molecular Formula | C16H17ClFNOS |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | N-[2-(chloromethyl)cyclohexyl]-6-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC1CCCCC1CCl)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C16H17ClFNOS/c17-9-11-3-1-2-4-13(11)19-16(20)15-7-10-5-6-12(18)8-14(10)21-15/h5-8,11,13H,1-4,9H2,(H,19,20) |
| InChIKey | ORLKZVGSGPXETR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|