C15H15BrFNOS — CID 114312010
N-(2-bromocyclohexyl)-6-fluoro-1-benzothiophene-2-carboxamide (PubChem CID 114312010) has the molecular formula C15H15BrFNOS and a molecular weight of 356.26 g/mol. Its IUPAC name is N-(2-bromocyclohexyl)-6-fluoro-1-benzothiophene-2-carboxamide.
| Compound Name | N-(2-bromocyclohexyl)-6-fluoro-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 114312010 |
| Molecular Formula | C15H15BrFNOS |
| Molecular Weight | 356.26 g/mol |
| Exact Mass | 355.00 |
| IUPAC Name | N-(2-bromocyclohexyl)-6-fluoro-1-benzothiophene-2-carboxamide |
| SMILES | O=C(NC1CCCCC1Br)c1cc2ccc(F)cc2s1 |
| InChI | InChI=1S/C15H15BrFNOS/c16-11-3-1-2-4-12(11)18-15(19)14-7-9-5-6-10(17)8-13(9)20-14/h5-8,11-12H,1-4H2,(H,18,19) |
| InChIKey | ODXSPSYVVABQPB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.26 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|