C12H18N4O3 — CID 106368323
[2-[(6-amino-4-nitro-2-pyridinyl)amino]cyclohexyl]methanol (PubChem CID 106368323) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is [2-[(6-amino-4-nitro-2-pyridinyl)amino]cyclohexyl]methanol.
| Compound Name | [2-[(6-amino-4-nitro-2-pyridinyl)amino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 106368323 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | [2-[(6-amino-4-nitro-2-pyridinyl)amino]cyclohexyl]methanol |
| SMILES | Nc1cc([N+](=O)[O-])cc(NC2CCCCC2CO)n1 |
| InChI | InChI=1S/C12H18N4O3/c13-11-5-9(16(18)19)6-12(15-11)14-10-4-2-1-3-8(10)7-17/h5-6,8,10,17H,1-4,7H2,(H3,13,14,15) |
| InChIKey | INSNGQMTJPAYSL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 114.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|