C10H14N4O3 — CID 114121084
6-N-(3-methoxycyclobutyl)-4-nitropyridine-2,6-diamine (PubChem CID 114121084) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 6-N-(3-methoxycyclobutyl)-4-nitropyridine-2,6-diamine.
| Compound Name | 6-N-(3-methoxycyclobutyl)-4-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 114121084 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 6-N-(3-methoxycyclobutyl)-4-nitropyridine-2,6-diamine |
| SMILES | COC1CC(Nc2cc([N+](=O)[O-])cc(N)n2)C1 |
| InChI | InChI=1S/C10H14N4O3/c1-17-8-2-6(3-8)12-10-5-7(14(15)16)4-9(11)13-10/h4-6,8H,2-3H2,1H3,(H3,11,12,13) |
| InChIKey | DYDSIOLQAVYVAL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|