C11H16N4O3 — CID 114118406
2-N-(3-methoxycyclopentyl)-3-nitropyridine-2,6-diamine (PubChem CID 114118406) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-N-(3-methoxycyclopentyl)-3-nitropyridine-2,6-diamine.
| Compound Name | 2-N-(3-methoxycyclopentyl)-3-nitropyridine-2,6-diamine |
|---|---|
| PubChem CID | 114118406 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-N-(3-methoxycyclopentyl)-3-nitropyridine-2,6-diamine |
| SMILES | COC1CCC(Nc2nc(N)ccc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C11H16N4O3/c1-18-8-3-2-7(6-8)13-11-9(15(16)17)4-5-10(12)14-11/h4-5,7-8H,2-3,6H2,1H3,(H3,12,13,14) |
| InChIKey | DTDGFYHMHJCJQI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 103.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|