C15H28O3Si — CID 10636834
(1S,4R,5S,7R)-4-[tert-butyl(dimethyl)silyl]oxy-1,7-dimethyl-8-oxabicyclo[3.2.1]octan-3-one (PubChem CID 10636834) has the molecular formula C15H28O3Si and a molecular weight of 284.47 g/mol. Its IUPAC name is (1S,4R,5S,7R)-4-[tert-butyl(dimethyl)silyl]oxy-1,7-dimethyl-8-oxabicyclo[3.2.1]octan-3-one.
| Compound Name | (1S,4R,5S,7R)-4-[tert-butyl(dimethyl)silyl]oxy-1,7-dimethyl-8-oxabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 10636834 |
| Molecular Formula | C15H28O3Si |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (1S,4R,5S,7R)-4-[tert-butyl(dimethyl)silyl]oxy-1,7-dimethyl-8-oxabicyclo[3.2.1]octan-3-one |
| SMILES | C[C@@H]1C[C@@H]2O[C@@]1(C)CC(=O)[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H28O3Si/c1-10-8-12-13(11(16)9-15(10,5)17-12)18-19(6,7)14(2,3)4/h10,12-13H,8-9H2,1-7H3/t10-,12+,13+,15+/m1/s1 |
| InChIKey | OQMQTDTZLVPONY-HTUGSXCWSA-N |
| XLogP | 3.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|