C16H30O3Si — CID 11266524
(1R,2S,5S,7R)-2-[tert-butyl(dimethyl)silyl]oxy-1,5,7-trimethyl-8-oxabicyclo[3.2.1]octan-3-one (PubChem CID 11266524) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is (1R,2S,5S,7R)-2-[tert-butyl(dimethyl)silyl]oxy-1,5,7-trimethyl-8-oxabicyclo[3.2.1]octan-3-one.
| Compound Name | (1R,2S,5S,7R)-2-[tert-butyl(dimethyl)silyl]oxy-1,5,7-trimethyl-8-oxabicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 11266524 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (1R,2S,5S,7R)-2-[tert-butyl(dimethyl)silyl]oxy-1,5,7-trimethyl-8-oxabicyclo[3.2.1]octan-3-one |
| SMILES | C[C@@H]1C[C@@]2(C)CC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@]1(C)O2 |
| InChI | InChI=1S/C16H30O3Si/c1-11-9-15(5)10-12(17)13(16(11,6)19-15)18-20(7,8)14(2,3)4/h11,13H,9-10H2,1-8H3/t11-,13-,15+,16-/m1/s1 |
| InChIKey | JHEPJADMVFFBIZ-XABYNWHXSA-N |
| XLogP | 3.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|