C11H18N4O — CID 106368372
[2-[(2-hydrazinyl-4-pyridinyl)amino]cyclopentyl]methanol (PubChem CID 106368372) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is [2-[(2-hydrazinyl-4-pyridinyl)amino]cyclopentyl]methanol.
| Compound Name | [2-[(2-hydrazinyl-4-pyridinyl)amino]cyclopentyl]methanol |
|---|---|
| PubChem CID | 106368372 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | [2-[(2-hydrazinyl-4-pyridinyl)amino]cyclopentyl]methanol |
| SMILES | NNc1cc(NC2CCCC2CO)ccn1 |
| InChI | InChI=1S/C11H18N4O/c12-15-11-6-9(4-5-13-11)14-10-3-1-2-8(10)7-16/h4-6,8,10,16H,1-3,7,12H2,(H2,13,14,15) |
| InChIKey | KBBZFFAMMOQWDE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|