C10H14N2O — CID 130719040
[(1R,2R)-2-[(2-methyl-4-pyridinyl)amino]cyclopropyl]methanol (PubChem CID 130719040) has the molecular formula C10H14N2O and a molecular weight of 178.24 g/mol. Its IUPAC name is [(1R,2R)-2-[(2-methyl-4-pyridinyl)amino]cyclopropyl]methanol.
| Compound Name | [(1R,2R)-2-[(2-methyl-4-pyridinyl)amino]cyclopropyl]methanol |
|---|---|
| PubChem CID | 130719040 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | [(1R,2R)-2-[(2-methyl-4-pyridinyl)amino]cyclopropyl]methanol |
| SMILES | Cc1cc(N[C@@H]2C[C@H]2CO)ccn1 |
| InChI | InChI=1S/C10H14N2O/c1-7-4-9(2-3-11-7)12-10-5-8(10)6-13/h2-4,8,10,13H,5-6H2,1H3,(H,11,12)/t8-,10+/m0/s1 |
| InChIKey | RBEJWLBAUYMZQY-WCBMZHEXSA-N |
| XLogP | 1.18 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |