C9H12N2O — CID 130621194
[(1R,2R)-2-(pyridin-2-ylamino)cyclopropyl]methanol (PubChem CID 130621194) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is [(1R,2R)-2-(pyridin-2-ylamino)cyclopropyl]methanol.
| Compound Name | [(1R,2R)-2-(pyridin-2-ylamino)cyclopropyl]methanol |
|---|---|
| PubChem CID | 130621194 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | [(1R,2R)-2-(pyridin-2-ylamino)cyclopropyl]methanol |
| SMILES | OC[C@@H]1C[C@H]1Nc1ccccn1 |
| InChI | InChI=1S/C9H12N2O/c12-6-7-5-8(7)11-9-3-1-2-4-10-9/h1-4,7-8,12H,5-6H2,(H,10,11)/t7-,8+/m0/s1 |
| InChIKey | XOZJPUFFYXDXIE-JGVFFNPUSA-N |
| XLogP | 0.87 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |