C12H17N3O2 — CID 175008602
[(1R,2R)-2-(pyridin-2-ylamino)cyclohexyl] carbamate (PubChem CID 175008602) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is [(1R,2R)-2-(pyridin-2-ylamino)cyclohexyl] carbamate.
| Compound Name | [(1R,2R)-2-(pyridin-2-ylamino)cyclohexyl] carbamate |
|---|---|
| PubChem CID | 175008602 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | [(1R,2R)-2-(pyridin-2-ylamino)cyclohexyl] carbamate |
| SMILES | NC(=O)O[C@@H]1CCCC[C@H]1Nc1ccccn1 |
| InChI | InChI=1S/C12H17N3O2/c13-12(16)17-10-6-2-1-5-9(10)15-11-7-3-4-8-14-11/h3-4,7-10H,1-2,5-6H2,(H2,13,16)(H,14,15)/t9-,10-/m1/s1 |
| InChIKey | YITGVMPVKBJIFE-NXEZZACHSA-N |
| XLogP | 1.90 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |