C15H19N3O2 — CID 106368562
5-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2,4-dimethylbenzamide (PubChem CID 106368562) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 5-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2,4-dimethylbenzamide.
| Compound Name | 5-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 106368562 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 5-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2,4-dimethylbenzamide |
| SMILES | CCc1cnc(CNC(=O)c2cc(N)c(C)cc2C)o1 |
| InChI | InChI=1S/C15H19N3O2/c1-4-11-7-17-14(20-11)8-18-15(19)12-6-13(16)10(3)5-9(12)2/h5-7H,4,8,16H2,1-3H3,(H,18,19) |
| InChIKey | WNAHWRNVCDQBKE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|