C13H13F2N3O2 — CID 106377037
4-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-3,5-difluorobenzamide (PubChem CID 106377037) has the molecular formula C13H13F2N3O2 and a molecular weight of 281.26 g/mol. Its IUPAC name is 4-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-3,5-difluorobenzamide.
| Compound Name | 4-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 106377037 |
| Molecular Formula | C13H13F2N3O2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 4-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-3,5-difluorobenzamide |
| SMILES | CCc1cnc(CNC(=O)c2cc(F)c(N)c(F)c2)o1 |
| InChI | InChI=1S/C13H13F2N3O2/c1-2-8-5-17-11(20-8)6-18-13(19)7-3-9(14)12(16)10(15)4-7/h3-5H,2,6,16H2,1H3,(H,18,19) |
| InChIKey | UWGLTDVPNUIAEV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|