C12H15N5O2 — CID 106377448
N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-4-hydrazinylpyridine-2-carboxamide (PubChem CID 106377448) has the molecular formula C12H15N5O2 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-4-hydrazinylpyridine-2-carboxamide.
| Compound Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-4-hydrazinylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 106377448 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-4-hydrazinylpyridine-2-carboxamide |
| SMILES | CCc1cnc(CNC(=O)c2cc(NN)ccn2)o1 |
| InChI | InChI=1S/C12H15N5O2/c1-2-9-6-15-11(19-9)7-16-12(18)10-5-8(17-13)3-4-14-10/h3-6H,2,7,13H2,1H3,(H,14,17)(H,16,18) |
| InChIKey | OFGVXEDGYZRQED-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|