C13H16ClN3O3S — CID 106368919
3-amino-4-chloro-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-5-methylbenzenesulfonamide (PubChem CID 106368919) has the molecular formula C13H16ClN3O3S and a molecular weight of 329.81 g/mol. Its IUPAC name is 3-amino-4-chloro-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-5-methylbenzenesulfonamide.
| Compound Name | 3-amino-4-chloro-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106368919 |
| Molecular Formula | C13H16ClN3O3S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 3-amino-4-chloro-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-5-methylbenzenesulfonamide |
| SMILES | CCc1cnc(CNS(=O)(=O)c2cc(C)c(Cl)c(N)c2)o1 |
| InChI | InChI=1S/C13H16ClN3O3S/c1-3-9-6-16-12(20-9)7-17-21(18,19)10-4-8(2)13(14)11(15)5-10/h4-6,17H,3,7,15H2,1-2H3 |
| InChIKey | XVGCHTWHZUFGED-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|