C12H13Cl2N3O3S — CID 106368958
3-amino-2,4-dichloro-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]benzenesulfonamide (PubChem CID 106368958) has the molecular formula C12H13Cl2N3O3S and a molecular weight of 350.23 g/mol. Its IUPAC name is 3-amino-2,4-dichloro-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]benzenesulfonamide.
| Compound Name | 3-amino-2,4-dichloro-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106368958 |
| Molecular Formula | C12H13Cl2N3O3S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 3-amino-2,4-dichloro-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]benzenesulfonamide |
| SMILES | CCc1cnc(CNS(=O)(=O)c2ccc(Cl)c(N)c2Cl)o1 |
| InChI | InChI=1S/C12H13Cl2N3O3S/c1-2-7-5-16-10(20-7)6-17-21(18,19)9-4-3-8(13)12(15)11(9)14/h3-5,17H,2,6,15H2,1H3 |
| InChIKey | HKIMQHACWVIPMV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|