C13H17N3O4S — CID 106368983
5-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methoxybenzenesulfonamide (PubChem CID 106368983) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 5-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methoxybenzenesulfonamide.
| Compound Name | 5-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 106368983 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 5-amino-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methoxybenzenesulfonamide |
| SMILES | CCc1cnc(CNS(=O)(=O)c2cc(N)ccc2OC)o1 |
| InChI | InChI=1S/C13H17N3O4S/c1-3-10-7-15-13(20-10)8-16-21(17,18)12-6-9(14)4-5-11(12)19-2/h4-7,16H,3,8,14H2,1-2H3 |
| InChIKey | CGXQAUPODBRBCZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|