C13H18N4O3S — CID 106369551
5-amino-2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-N-methylbenzenesulfonamide (PubChem CID 106369551) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 5-amino-2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-N-methylbenzenesulfonamide.
| Compound Name | 5-amino-2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106369551 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 5-amino-2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]-N-methylbenzenesulfonamide |
| SMILES | CCc1cnc(CNc2ccc(N)cc2S(=O)(=O)NC)o1 |
| InChI | InChI=1S/C13H18N4O3S/c1-3-10-7-17-13(20-10)8-16-11-5-4-9(14)6-12(11)21(18,19)15-2/h4-7,15-16H,3,8,14H2,1-2H3 |
| InChIKey | MRUVIXJFTFFPJE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|