C12H16N4O3S — CID 106369789
5-amino-2-methyl-3-[(5-methyl-1,3-oxazol-2-yl)methylamino]benzenesulfonamide (PubChem CID 106369789) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is 5-amino-2-methyl-3-[(5-methyl-1,3-oxazol-2-yl)methylamino]benzenesulfonamide.
| Compound Name | 5-amino-2-methyl-3-[(5-methyl-1,3-oxazol-2-yl)methylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 106369789 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 5-amino-2-methyl-3-[(5-methyl-1,3-oxazol-2-yl)methylamino]benzenesulfonamide |
| SMILES | Cc1cnc(CNc2cc(N)cc(S(N)(=O)=O)c2C)o1 |
| InChI | InChI=1S/C12H16N4O3S/c1-7-5-16-12(19-7)6-15-10-3-9(13)4-11(8(10)2)20(14,17)18/h3-5,15H,6,13H2,1-2H3,(H2,14,17,18) |
| InChIKey | HLFFEXMTHFIYCX-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 124.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|