C14H18N2O3 — CID 106370137
5-methoxy-2-[1-[(5-methyl-1,3-oxazol-2-yl)methylamino]ethyl]phenol (PubChem CID 106370137) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 5-methoxy-2-[1-[(5-methyl-1,3-oxazol-2-yl)methylamino]ethyl]phenol.
| Compound Name | 5-methoxy-2-[1-[(5-methyl-1,3-oxazol-2-yl)methylamino]ethyl]phenol |
|---|---|
| PubChem CID | 106370137 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 5-methoxy-2-[1-[(5-methyl-1,3-oxazol-2-yl)methylamino]ethyl]phenol |
| SMILES | COc1ccc(C(C)NCc2ncc(C)o2)c(O)c1 |
| InChI | InChI=1S/C14H18N2O3/c1-9-7-16-14(19-9)8-15-10(2)12-5-4-11(18-3)6-13(12)17/h4-7,10,15,17H,8H2,1-3H3 |
| InChIKey | NYLCPTLXZUDTAQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 67.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|