C16H21NO2S — CID 65246248
2-[1-[(4,5-dimethylthiophen-2-yl)methylamino]ethyl]-5-methoxyphenol (PubChem CID 65246248) has the molecular formula C16H21NO2S and a molecular weight of 291.42 g/mol. Its IUPAC name is 2-[1-[(4,5-dimethylthiophen-2-yl)methylamino]ethyl]-5-methoxyphenol.
| Compound Name | 2-[1-[(4,5-dimethylthiophen-2-yl)methylamino]ethyl]-5-methoxyphenol |
|---|---|
| PubChem CID | 65246248 |
| Molecular Formula | C16H21NO2S |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-[1-[(4,5-dimethylthiophen-2-yl)methylamino]ethyl]-5-methoxyphenol |
| SMILES | COc1ccc(C(C)NCc2cc(C)c(C)s2)c(O)c1 |
| InChI | InChI=1S/C16H21NO2S/c1-10-7-14(20-12(10)3)9-17-11(2)15-6-5-13(19-4)8-16(15)18/h5-8,11,17-18H,9H2,1-4H3 |
| InChIKey | VYESDXRRCHPRJM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|