C12H19N3OS — CID 106370563
1-cyclopentyl-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]thiourea (PubChem CID 106370563) has the molecular formula C12H19N3OS and a molecular weight of 253.37 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]thiourea.
| Compound Name | 1-cyclopentyl-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]thiourea |
|---|---|
| PubChem CID | 106370563 |
| Molecular Formula | C12H19N3OS |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-cyclopentyl-3-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]thiourea |
| SMILES | Cc1nc(CNC(=S)NC2CCCC2)oc1C |
| InChI | InChI=1S/C12H19N3OS/c1-8-9(2)16-11(14-8)7-13-12(17)15-10-5-3-4-6-10/h10H,3-7H2,1-2H3,(H2,13,15,17) |
| InChIKey | SUWWGFYROXRRAZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|