C17H30IN5O2 — CID 109431554
N-cyclohexyl-2-[[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 109431554) has the molecular formula C17H30IN5O2 and a molecular weight of 463.36 g/mol. Its IUPAC name is N-cyclohexyl-2-[[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N-cyclohexyl-2-[[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 109431554 |
| Molecular Formula | C17H30IN5O2 |
| Molecular Weight | 463.36 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | N-cyclohexyl-2-[[[(4,5-dimethyl-1,3-oxazol-2-yl)methylamino]-(ethylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC1CCCCC1)NCc1nc(C)c(C)o1.I |
| InChI | InChI=1S/C17H29N5O2.HI/c1-4-18-17(20-11-16-21-12(2)13(3)24-16)19-10-15(23)22-14-8-6-5-7-9-14;/h14H,4-11H2,1-3H3,(H,22,23)(H2,18,19,20);1H |
| InChIKey | RTOWHVRGDBJSDA-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|