About N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylpiperidine-2-carboxamide
N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylpiperidine-2-carboxamide (PubChem CID 106370884) has the molecular formula C13H21N3O2
and a molecular weight of 251.33 g/mol. Its IUPAC name is N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylpiperidine-2-carboxamide.
Molecular Properties
| Compound Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylpiperidine-2-carboxamide |
| PubChem CID | 106370884 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylpiperidine-2-carboxamide |
| SMILES | CCc1cnc(CNC(=O)C2(C)CCCCN2)o1 |
| InChI | InChI=1S/C13H21N3O2/c1-3-10-8-14-11(18-10)9-15-12(17)13(2)6-4-5-7-16-13/h8,16H,3-7,9H2,1-2H3,(H,15,17) |
| InChIKey | PROINUBUTLHKEQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylpiperidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylpiperidine-2-carboxamide?
The IUPAC name of N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylpiperidine-2-carboxamide (CID 106370884) is N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylpiperidine-2-carboxamide.
What is the SMILES notation for N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylpiperidine-2-carboxamide?
The canonical SMILES for N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylpiperidine-2-carboxamide is CCc1cnc(CNC(=O)C2(C)CCCCN2)o1.
What is the InChIKey of N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylpiperidine-2-carboxamide?
The InChIKey is PROINUBUTLHKEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O2/c1-3-10-8-14-11(18-10)9-15-12(17)13(2)6-4-5-7-16-13/h8,16H,3-7,9H2,1-2H3,(H,15,17).
What are the key properties of N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylpiperidine-2-carboxamide?
N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylpiperidine-2-carboxamide has a molecular weight of 251.33 g/mol, XLogP of 1.39, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-2-methylpiperidine-2-carboxamide is sourced from PubChem (CID 106370884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).