C13H13N3O — CID 106371995
2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]benzonitrile (PubChem CID 106371995) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]benzonitrile.
| Compound Name | 2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 106371995 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-[(5-ethyl-1,3-oxazol-2-yl)methylamino]benzonitrile |
| SMILES | CCc1cnc(CNc2ccccc2C#N)o1 |
| InChI | InChI=1S/C13H13N3O/c1-2-11-8-16-13(17-11)9-15-12-6-4-3-5-10(12)7-14/h3-6,8,15H,2,9H2,1H3 |
| InChIKey | WQDJQZMDRGYPFM-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |