C13H12ClN3O — CID 103764561
2-chloro-4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]benzonitrile (PubChem CID 103764561) has the molecular formula C13H12ClN3O and a molecular weight of 261.71 g/mol. Its IUPAC name is 2-chloro-4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]benzonitrile.
| Compound Name | 2-chloro-4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]benzonitrile |
|---|---|
| PubChem CID | 103764561 |
| Molecular Formula | C13H12ClN3O |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 2-chloro-4-[(5-ethyl-1,3-oxazol-2-yl)methylamino]benzonitrile |
| SMILES | CCc1cnc(CNc2ccc(C#N)c(Cl)c2)o1 |
| InChI | InChI=1S/C13H12ClN3O/c1-2-11-7-17-13(18-11)8-16-10-4-3-9(6-15)12(14)5-10/h3-5,7,16H,2,8H2,1H3 |
| InChIKey | YBIMOQJGMFSVAJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |