C17H25NO3 — CID 10637333
tert-butyl (2S,4S)-2-benzyl-4-methyl-1,3-oxazinane-3-carboxylate (PubChem CID 10637333) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-benzyl-4-methyl-1,3-oxazinane-3-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-benzyl-4-methyl-1,3-oxazinane-3-carboxylate |
|---|---|
| PubChem CID | 10637333 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | tert-butyl (2S,4S)-2-benzyl-4-methyl-1,3-oxazinane-3-carboxylate |
| SMILES | C[C@H]1CCO[C@@H](Cc2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H25NO3/c1-13-10-11-20-15(12-14-8-6-5-7-9-14)18(13)16(19)21-17(2,3)4/h5-9,13,15H,10-12H2,1-4H3/t13-,15-/m0/s1 |
| InChIKey | AFUVZJSWJZAFAG-ZFWWWQNUSA-N |
| XLogP | 3.60 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |