C17H28N2O2 — CID 122189544
3-[methyl(3-phenylpropyl)amino]butyl N,N-dimethylcarbamate (PubChem CID 122189544) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 3-[methyl(3-phenylpropyl)amino]butyl N,N-dimethylcarbamate.
| Compound Name | 3-[methyl(3-phenylpropyl)amino]butyl N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 122189544 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 3-[methyl(3-phenylpropyl)amino]butyl N,N-dimethylcarbamate |
| SMILES | CC(CCOC(=O)N(C)C)N(C)CCCc1ccccc1 |
| InChI | InChI=1S/C17H28N2O2/c1-15(12-14-21-17(20)18(2)3)19(4)13-8-11-16-9-6-5-7-10-16/h5-7,9-10,15H,8,11-14H2,1-4H3 |
| InChIKey | PMVGRJWGUNJKAW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |