C15H16ClN3O — CID 106375435
2-[[2-(chloromethyl)-6-methylbenzimidazol-1-yl]methyl]-5-ethyl-1,3-oxazole (PubChem CID 106375435) has the molecular formula C15H16ClN3O and a molecular weight of 289.77 g/mol. Its IUPAC name is 2-[[2-(chloromethyl)-6-methylbenzimidazol-1-yl]methyl]-5-ethyl-1,3-oxazole.
| Compound Name | 2-[[2-(chloromethyl)-6-methylbenzimidazol-1-yl]methyl]-5-ethyl-1,3-oxazole |
|---|---|
| PubChem CID | 106375435 |
| Molecular Formula | C15H16ClN3O |
| Molecular Weight | 289.77 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-[[2-(chloromethyl)-6-methylbenzimidazol-1-yl]methyl]-5-ethyl-1,3-oxazole |
| SMILES | CCc1cnc(Cn2c(CCl)nc3ccc(C)cc32)o1 |
| InChI | InChI=1S/C15H16ClN3O/c1-3-11-8-17-15(20-11)9-19-13-6-10(2)4-5-12(13)18-14(19)7-16/h4-6,8H,3,7,9H2,1-2H3 |
| InChIKey | GCHYFZSMIYOZAT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 43.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.77 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|