C11H11ClN4O2 — CID 106375447
4-chloro-2-methyl-6-[(5-methyl-1,3-oxazol-2-yl)methylamino]pyrimidine-5-carbaldehyde (PubChem CID 106375447) has the molecular formula C11H11ClN4O2 and a molecular weight of 266.69 g/mol. Its IUPAC name is 4-chloro-2-methyl-6-[(5-methyl-1,3-oxazol-2-yl)methylamino]pyrimidine-5-carbaldehyde.
| Compound Name | 4-chloro-2-methyl-6-[(5-methyl-1,3-oxazol-2-yl)methylamino]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 106375447 |
| Molecular Formula | C11H11ClN4O2 |
| Molecular Weight | 266.69 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 4-chloro-2-methyl-6-[(5-methyl-1,3-oxazol-2-yl)methylamino]pyrimidine-5-carbaldehyde |
| SMILES | Cc1nc(Cl)c(C=O)c(NCc2ncc(C)o2)n1 |
| InChI | InChI=1S/C11H11ClN4O2/c1-6-3-13-9(18-6)4-14-11-8(5-17)10(12)15-7(2)16-11/h3,5H,4H2,1-2H3,(H,14,15,16) |
| InChIKey | QZSUYOWGRVNBRY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.69 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|