C14H24N4O3 — CID 106375729
2-[(Z)-N'-hydroxycarbamimidoyl]-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-propylpentanamide (PubChem CID 106375729) has the molecular formula C14H24N4O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 2-[(Z)-N'-hydroxycarbamimidoyl]-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-propylpentanamide.
| Compound Name | 2-[(Z)-N'-hydroxycarbamimidoyl]-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-propylpentanamide |
|---|---|
| PubChem CID | 106375729 |
| Molecular Formula | C14H24N4O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 2-[(Z)-N'-hydroxycarbamimidoyl]-N-[(5-methyl-1,3-oxazol-2-yl)methyl]-2-propylpentanamide |
| SMILES | CCCC(CCC)(C(=O)NCc1ncc(C)o1)/C(N)=N/O |
| InChI | InChI=1S/C14H24N4O3/c1-4-6-14(7-5-2,12(15)18-20)13(19)17-9-11-16-8-10(3)21-11/h8,20H,4-7,9H2,1-3H3,(H2,15,18)(H,17,19) |
| InChIKey | FOGKVDNEWOCIPV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 113.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|