C14H25N3O — CID 106376633
2-[(3-tert-butylpiperazin-1-yl)methyl]-5-ethyl-1,3-oxazole (PubChem CID 106376633) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is 2-[(3-tert-butylpiperazin-1-yl)methyl]-5-ethyl-1,3-oxazole.
| Compound Name | 2-[(3-tert-butylpiperazin-1-yl)methyl]-5-ethyl-1,3-oxazole |
|---|---|
| PubChem CID | 106376633 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 2-[(3-tert-butylpiperazin-1-yl)methyl]-5-ethyl-1,3-oxazole |
| SMILES | CCc1cnc(CN2CCNC(C(C)(C)C)C2)o1 |
| InChI | InChI=1S/C14H25N3O/c1-5-11-8-16-13(18-11)10-17-7-6-15-12(9-17)14(2,3)4/h8,12,15H,5-7,9-10H2,1-4H3 |
| InChIKey | IXQWVJUVUIIKTR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 41.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |