About 3-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-1,4-diazepane
3-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-1,4-diazepane (PubChem CID 64869919) has the molecular formula C16H28N2S
and a molecular weight of 280.48 g/mol. Its IUPAC name is 3-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-1,4-diazepane.
Molecular Properties
| Compound Name | 3-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-1,4-diazepane |
| PubChem CID | 64869919 |
| Molecular Formula | C16H28N2S |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | 3-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-1,4-diazepane |
| SMILES | CCc1ccc(CN2CCCNC(C(C)(C)C)C2)s1 |
| InChI | InChI=1S/C16H28N2S/c1-5-13-7-8-14(19-13)11-18-10-6-9-17-15(12-18)16(2,3)4/h7-8,15,17H,5-6,9-12H2,1-4H3 |
| InChIKey | TZHWMDOTNYXVSV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-1,4-diazepane?
The IUPAC name of 3-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-1,4-diazepane (CID 64869919) is 3-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-1,4-diazepane.
What is the SMILES notation for 3-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-1,4-diazepane?
The canonical SMILES for 3-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-1,4-diazepane is CCc1ccc(CN2CCCNC(C(C)(C)C)C2)s1.
What is the InChIKey of 3-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-1,4-diazepane?
The InChIKey is TZHWMDOTNYXVSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2S/c1-5-13-7-8-14(19-13)11-18-10-6-9-17-15(12-18)16(2,3)4/h7-8,15,17H,5-6,9-12H2,1-4H3.
What are the key properties of 3-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-1,4-diazepane?
3-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-1,4-diazepane has a molecular weight of 280.48 g/mol, XLogP of 3.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1-[(5-ethylthiophen-2-yl)methyl]-1,4-diazepane is sourced from PubChem (CID 64869919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).