C14H24N2S — CID 64872293
3-tert-butyl-1-(thiophen-2-ylmethyl)-1,4-diazepane (PubChem CID 64872293) has the molecular formula C14H24N2S and a molecular weight of 252.43 g/mol. Its IUPAC name is 3-tert-butyl-1-(thiophen-2-ylmethyl)-1,4-diazepane.
| Compound Name | 3-tert-butyl-1-(thiophen-2-ylmethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 64872293 |
| Molecular Formula | C14H24N2S |
| Molecular Weight | 252.43 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 3-tert-butyl-1-(thiophen-2-ylmethyl)-1,4-diazepane |
| SMILES | CC(C)(C)C1CN(Cc2cccs2)CCCN1 |
| InChI | InChI=1S/C14H24N2S/c1-14(2,3)13-11-16(8-5-7-15-13)10-12-6-4-9-17-12/h4,6,9,13,15H,5,7-8,10-11H2,1-3H3 |
| InChIKey | JGECDCWOKCTDMW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.43 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |