C17H28N2S — CID 64843223
8-tert-butyl-6-(thiophen-2-ylmethyl)-6,9-diazaspiro[4.5]decane (PubChem CID 64843223) has the molecular formula C17H28N2S and a molecular weight of 292.49 g/mol. Its IUPAC name is 8-tert-butyl-6-(thiophen-2-ylmethyl)-6,9-diazaspiro[4.5]decane.
| Compound Name | 8-tert-butyl-6-(thiophen-2-ylmethyl)-6,9-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 64843223 |
| Molecular Formula | C17H28N2S |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 8-tert-butyl-6-(thiophen-2-ylmethyl)-6,9-diazaspiro[4.5]decane |
| SMILES | CC(C)(C)C1CN(Cc2cccs2)C2(CCCC2)CN1 |
| InChI | InChI=1S/C17H28N2S/c1-16(2,3)15-12-19(11-14-7-6-10-20-14)17(13-18-15)8-4-5-9-17/h6-7,10,15,18H,4-5,8-9,11-13H2,1-3H3 |
| InChIKey | PQENAAZFSUCYKA-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |