C16H25BrN2 — CID 64870115
1-[(3-bromophenyl)methyl]-3-tert-butyl-1,4-diazepane (PubChem CID 64870115) has the molecular formula C16H25BrN2 and a molecular weight of 325.29 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-3-tert-butyl-1,4-diazepane.
| Compound Name | 1-[(3-bromophenyl)methyl]-3-tert-butyl-1,4-diazepane |
|---|---|
| PubChem CID | 64870115 |
| Molecular Formula | C16H25BrN2 |
| Molecular Weight | 325.29 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-3-tert-butyl-1,4-diazepane |
| SMILES | CC(C)(C)C1CN(Cc2cccc(Br)c2)CCCN1 |
| InChI | InChI=1S/C16H25BrN2/c1-16(2,3)15-12-19(9-5-8-18-15)11-13-6-4-7-14(17)10-13/h4,6-7,10,15,18H,5,8-9,11-12H2,1-3H3 |
| InChIKey | JIQVYCPLJCWYCT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.29 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |