C14H19N3O3 — CID 106376977
2-[(5-ethyl-1,3-oxazol-2-yl)methyl]-3,4,7,8,9,9a-hexahydropyrrolo[1,2-a][1,4]diazepine-1,5-dione (PubChem CID 106376977) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-[(5-ethyl-1,3-oxazol-2-yl)methyl]-3,4,7,8,9,9a-hexahydropyrrolo[1,2-a][1,4]diazepine-1,5-dione.
| Compound Name | 2-[(5-ethyl-1,3-oxazol-2-yl)methyl]-3,4,7,8,9,9a-hexahydropyrrolo[1,2-a][1,4]diazepine-1,5-dione |
|---|---|
| PubChem CID | 106376977 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | 2-[(5-ethyl-1,3-oxazol-2-yl)methyl]-3,4,7,8,9,9a-hexahydropyrrolo[1,2-a][1,4]diazepine-1,5-dione |
| SMILES | CCc1cnc(CN2CCC(=O)N3CCCC3C2=O)o1 |
| InChI | InChI=1S/C14H19N3O3/c1-2-10-8-15-12(20-10)9-16-7-5-13(18)17-6-3-4-11(17)14(16)19/h8,11H,2-7,9H2,1H3 |
| InChIKey | AHSQSWDXTICTRE-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |